cas: 1191078-74-6 — see every product listed under this CAS number, including other names
1-Amino-3,6,9,12,15-pentaoxaoctadecan-18-oic acid, 97% (CAS 1191078-74-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867271-50MG |
| cas | 1191078-74-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 237.43 Pln | |
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 591.48 Pln | |
| Fluorochem | 5g | 2320.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1191078-74-6) is a chemical compound with the molecular formula C13H27NO7 and a molecular weight of 309.36 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ZTYIBTVLGAIXDY-UHFFFAOYSA-N.
| Molecular formula | C13H27NO7 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ZTYIBTVLGAIXDY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)