Amino-PEG5-C2-acid 96%
cas: 1191078-74-6 — see every product listed under this CAS number, including other names
Amino-PEG5-C2-acid 96% (CAS 1191078-74-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750214-50mg |
| cas | 1191078-74-6 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 2867.94 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A750214 |
3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1191078-74-6) is a chemical compound with the molecular formula C13H27NO7 and a molecular weight of 309.36 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ZTYIBTVLGAIXDY-UHFFFAOYSA-N.
| Molecular formula | C13H27NO7 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ZTYIBTVLGAIXDY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Amino-PEG5-acid, Amino-PEG5-C2-acid, Amino-PEG5-COOH, Amino-PEG5-propionic Acid, Amine-PEG5-COOH, 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid, orb1909525, Amino-PEG5-acid,H2N-PEG5-COOH, 4,7,10,13,16-Pentaoxaoctadecanoic acid, 18-amino-, alpha,omega-amine--propionic acid pentaethylene glycol