cas: 1363378-23-7 — see every product listed under this CAS number, including other names
1-Azetidinecarboxylic acid, 2-(bromomethyl)-, 1,1-dimethylethyl ester, (2S)-, 98%, 98% (CAS 1363378-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122NY-100mg |
| cas | 1363378-23-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 870.80 Pln | |
| Chemat | 1g | 2819.60 Pln | |
| Chemat | 5g | 11574.80 Pln | |
| Chemat | 10g | 18630.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-(bromomethyl)azetidine-1-carboxylate (CAS 1363378-23-7) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl (2S)-2-(bromomethyl)azetidine-1-carboxylate. InChIKey: YDUBHKXBYBMWRH-ZETCQYMHSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl (2S)-2-(bromomethyl)azetidine-1-carboxylate |
| InChIKey | YDUBHKXBYBMWRH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1CBr |
Computed by PubChem (NCBI)