cas: 1493737-08-8 — see every product listed under this CAS number, including other names
1-Azetidinecarboxylic acid, 3-cyano-3-hydroxy-, 1,1-dimethylethyl ester, 98%, 98% (CAS 1493737-08-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKXA-100mg |
| cas | 1493737-08-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 141.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 25g | 2661.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate (CAS 1493737-08-8) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate. InChIKey: ORIZOARFGLMZHN-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate |
| InChIKey | ORIZOARFGLMZHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C#N)O |
Computed by PubChem (NCBI)