cas: 1493737-08-8 — see every product listed under this CAS number, including other names
tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate 98% (CAS 1493737-08-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A771443-10g |
| cas | 1493737-08-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1154.69 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 743.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A771443 |
Tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate (CAS 1493737-08-8) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate. InChIKey: ORIZOARFGLMZHN-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 3-cyano-3-hydroxyazetidine-1-carboxylate |
| InChIKey | ORIZOARFGLMZHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C#N)O |
Computed by PubChem (NCBI)