cas: 445490-78-8 — see every product listed under this CAS number, including other names
1-BOC-7-(2-HYDROXYETHYL)-3,4-DIHYDRO-1,8-NAPHTHYRIDINE, 98% (CAS 445490-78-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301831-100MG |
| cas | 445490-78-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 1424.52 Pln | |
| Fluorochem | 5g | 6761.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (CAS 445490-78-8) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate. InChIKey: NKAJFZNFIIPKSQ-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| InChIKey | NKAJFZNFIIPKSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1N=C(C=C2)CCO |
Computed by PubChem (NCBI)