cas: 445490-78-8 — see every product listed under this CAS number, including other names
tert-Butyl 7-(2-hydroxyethyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate, 97%, 97% (CAS 445490-78-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9G1-25mg |
| cas | 445490-78-8 |
| size | 25mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 122.00 Pln | |
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1566.80 Pln | |
| Chemat | 5g | 7293.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (CAS 445490-78-8) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate. InChIKey: NKAJFZNFIIPKSQ-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| InChIKey | NKAJFZNFIIPKSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1N=C(C=C2)CCO |
Computed by PubChem (NCBI)