cas: 15923-40-7 — see every product listed under this CAS number, including other names
1-Benzoylazepan-4-one, 95%, 95% (CAS 15923-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QL1-1g |
| cas | 15923-40-7 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 506.00 Pln | |
| Chemat | 25g | 1610.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzoylazepan-4-one (CAS 15923-40-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1-benzoylazepan-4-one. InChIKey: CFZRTDHGRHTNHP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 1-benzoylazepan-4-one |
| InChIKey | CFZRTDHGRHTNHP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCN(C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)