CAS 15923-40-7 appears in our catalog under these names: N-Benzoyl-4-perhydroazepinone, 95%, 1-Benzoylazepan-4-one, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
1-benzoylazepan-4-one (CAS 15923-40-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1-benzoylazepan-4-one. InChIKey: CFZRTDHGRHTNHP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 1-benzoylazepan-4-one |
| InChIKey | CFZRTDHGRHTNHP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCN(C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)