cas: 154548-45-5 — see every product listed under this CAS number, including other names
1-Benzyl 3-ethyl 4-oxopiperidine-1,3-dicarboxylate, 95% (CAS 154548-45-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079306-100MG |
| cas | 154548-45-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1315.18 Pln | |
| Fluorochem | 10g | 2262.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate (CAS 154548-45-5) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: 1-O-benzyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate. InChIKey: DYBIHRBNPRCTAS-UHFFFAOYSA-N.
| Molecular formula | C16H19NO5 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | 1-O-benzyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate |
| InChIKey | DYBIHRBNPRCTAS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)