CAS 161183-22-8 appears in our catalog under these names: Docetaxel Impurity 30, Docetaxel Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-3-acetyloxy-2-oxo-4-phenylazetidine-1-carboxylate (CAS 161183-22-8) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: tert-butyl (3R,4S)-3-acetyloxy-2-oxo-4-phenylazetidine-1-carboxylate. InChIKey: UXAJYQMKDOKJIF-QWHCGFSZSA-N.
| Molecular formula | C16H19NO5 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-acetyloxy-2-oxo-4-phenylazetidine-1-carboxylate |
| InChIKey | UXAJYQMKDOKJIF-QWHCGFSZSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](N(C1=O)C(=O)OC(C)(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)