Products 1389251-05-1

CAS 1389251-05-1 is the registry number for (S)-1-Benzyl 2-ethyl 4-oxopiperidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-benzyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate (CAS 1389251-05-1) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: 1-O-benzyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate. InChIKey: DLDMXXVHUGJXPY-AWEZNQCLSA-N.

Identity
Molecular formulaC16H19NO5
Molecular weight305.32 g/mol
IUPAC name1-O-benzyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate
InChIKeyDLDMXXVHUGJXPY-AWEZNQCLSA-N
SMILESCCOC(=O)[C@@H]1CC(=O)CCN1C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)