Products 1951438-82-6

CAS 1951438-82-6 is the registry number for 1-Benzyl-4-oxo-piperidine-2,3-dicarboxylic acid dimethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 1-benzyl-4-oxopiperidine-2,3-dicarboxylate (CAS 1951438-82-6) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: dimethyl 1-benzyl-4-oxopiperidine-2,3-dicarboxylate. InChIKey: OYUQDMYUAQYUDR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19NO5
Molecular weight305.32 g/mol
IUPAC namedimethyl 1-benzyl-4-oxopiperidine-2,3-dicarboxylate
InChIKeyOYUQDMYUAQYUDR-UHFFFAOYSA-N
SMILESCOC(=O)C1C(N(CCC1=O)CC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)