cas: 1236144-51-6 — see every product listed under this CAS number, including other names
1-Benzyl 3-tert-butyl azetidine-1,3-dicarboxylate, 97% (CAS 1236144-51-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F451268-100MG |
| cas | 1236144-51-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 500mg | 690.40 Pln | |
| Fluorochem | 1g | 1002.79 Pln | |
| Fluorochem | 5g | 2845.89 Pln | |
| Fluorochem | 10g | 5001.38 Pln | |
| Fluorochem | 25g | 9307.16 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 3-O-tert-butyl azetidine-1,3-dicarboxylate (CAS 1236144-51-6) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 1-O-benzyl 3-O-tert-butyl azetidine-1,3-dicarboxylate. InChIKey: MBELYSROOPOIIB-UHFFFAOYSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 1-O-benzyl 3-O-tert-butyl azetidine-1,3-dicarboxylate |
| InChIKey | MBELYSROOPOIIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)