Products 727382-68-5

CAS 727382-68-5 is the registry number for 4-Benzyloxy-2-dimethylaminomethylene-3-oxo-butyric acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate (CAS 727382-68-5) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: ethyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate. InChIKey: GSSBCHMKZXJMBT-GXDHUFHOSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC nameethyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate
InChIKeyGSSBCHMKZXJMBT-GXDHUFHOSA-N
SMILESCCOC(=O)/C(=C/N(C)C)/C(=O)COCC1=CC=CC=C1

Computed by PubChem (NCBI)