cas: 31696-09-0 — see every product listed under this CAS number, including other names
1-Benzyl 4-ethyl 5-oxoazepane-1,4-dicarboxylate, 98%, 98% (CAS 31696-09-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q1O-250mg |
| cas | 31696-09-0 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 506.00 Pln | |
| Chemat | 25g | 933.20 Pln | |
| Chemat | 500g | 14688.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate (CAS 31696-09-0) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate. InChIKey: YMPFJXQFTCDJOB-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate |
| InChIKey | YMPFJXQFTCDJOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)