cas: 31696-09-0 — see every product listed under this CAS number, including other names
1-Benzyl 4-ethyl 5-oxoazepane-1,4-dicarboxylate, 98% (CAS 31696-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235448-1G |
| cas | 31696-09-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 529.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate (CAS 31696-09-0) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate. InChIKey: YMPFJXQFTCDJOB-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate |
| InChIKey | YMPFJXQFTCDJOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)