cas: 4706-43-8 — see every product listed under this CAS number, including other names
1-Benzyl-1H-benzo[d][1,2,3]triazole, 97% (CAS 4706-43-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F382483-250MG |
| cas | 4706-43-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1632.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-benzylbenzotriazole (CAS 4706-43-8) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 1-benzylbenzotriazole. InChIKey: OQVSPZZIBWDHOF-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 1-benzylbenzotriazole |
| InChIKey | OQVSPZZIBWDHOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=N2 |
Computed by PubChem (NCBI)