Products 50351-72-9
CAS 50351-72-9 is the registry number for 2-(Benzylamino)nicotinonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
2-(benzylamino)pyridine-3-carbonitrile (CAS 50351-72-9) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 2-(benzylamino)pyridine-3-carbonitrile. InChIKey: GSDQHSDPGWFMHN-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 2-(benzylamino)pyridine-3-carbonitrile |
| InChIKey | GSDQHSDPGWFMHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC=N2)C#N |
Computed by PubChem (NCBI)