CAS 4706-43-8 appears in our catalog under these names: 1-Benzyl-1h-benzo[d][1,2,3]triazole, 95%, 1-Benzyl-1H-benzo[d][1,2,3]triazole, 95%, 95%, 1-Benzyl-1H-benzo[d][1,2,3]triazole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-benzylbenzotriazole (CAS 4706-43-8) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 1-benzylbenzotriazole. InChIKey: OQVSPZZIBWDHOF-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 1-benzylbenzotriazole |
| InChIKey | OQVSPZZIBWDHOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=N2 |
Computed by PubChem (NCBI)