CAS 66519-70-8 appears in our catalog under these names: 2-Benzyl-2h-1,2,3-benzotriazole, 95%, 2-Benzyl-2H-benzo(d)(1,2,3)triazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-benzylbenzotriazole (CAS 66519-70-8) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 2-benzylbenzotriazole. InChIKey: LJVWBACGGDLQQX-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 2-benzylbenzotriazole |
| InChIKey | LJVWBACGGDLQQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2N=C3C=CC=CC3=N2 |
Computed by PubChem (NCBI)