cas: 2215-63-6 — see every product listed under this CAS number, including other names
1-Benzyl-1H-indazol-3-ol, >98.0%(GC) (CAS 2215-63-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2411-5G |
| cas | 2215-63-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 98.68 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-benzyl-2H-indazol-3-one (CAS 2215-63-6) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 1-benzyl-2H-indazol-3-one. InChIKey: SXPJFDSMKWLOAB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 1-benzyl-2H-indazol-3-one |
| InChIKey | SXPJFDSMKWLOAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)