cas: 862416-37-3 — see every product listed under this CAS number, including other names
1-Benzyl-3,3-difluoropyrrolidine hydrochloride, 95%, 95% (CAS 862416-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H48M-100mg |
| cas | 862416-37-3 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-3,3-difluoropyrrolidine;hydrochloride (CAS 862416-37-3) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 1-benzyl-3,3-difluoropyrrolidine;hydrochloride. InChIKey: DMDXILXXSNPPKZ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 1-benzyl-3,3-difluoropyrrolidine;hydrochloride |
| InChIKey | DMDXILXXSNPPKZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)