CAS 120635-25-8 appears in our catalog under these names: Mofegiline hydrochloride, 97%, Mofegiline HCl, 98%, Mofegiline hydrochloride, Mofegiline (hydrochloride), 99.57%, Mofegiline hydrochloride, 95.0%, 95.0%. Offered by: Combi-blocks, AmBeed, TargetMol, MedChemExpress, Chemat. Available pack sizes: 1g, 250mg, 2mg, 5mg, 10mg, 10mM/1mL, 100 mg, 5 mg.
(2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine;hydrochloride (CAS 120635-25-8) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: (2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine;hydrochloride. InChIKey: QUCNNQHLIHGBIA-HCUGZAAXSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | (2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine;hydrochloride |
| InChIKey | QUCNNQHLIHGBIA-HCUGZAAXSA-N |
| SMILES | C1=CC(=CC=C1CC/C(=C\F)/CN)F.Cl |
Computed by PubChem (NCBI)