Products 1004618-89-6

CAS 1004618-89-6 is the registry number for 4-(3,5-Difluorophenyl)piperidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(3,5-difluorophenyl)piperidine;hydrochloride (CAS 1004618-89-6) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 4-(3,5-difluorophenyl)piperidine;hydrochloride. InChIKey: PHJMPFBDUAVODB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClF2N
Molecular weight233.68 g/mol
IUPAC name4-(3,5-difluorophenyl)piperidine;hydrochloride
InChIKeyPHJMPFBDUAVODB-UHFFFAOYSA-N
SMILESC1CNCCC1C2=CC(=CC(=C2)F)F.Cl

Computed by PubChem (NCBI)