CAS 1909335-91-6 appears in our catalog under these names: [1-(2,6-difluorophenyl)cyclobutyl]methanamine hydrochloride, 95%, (1–(2,6–difluorophenyl)cyclobutyl)methanamine hydrochloride, (1-(2,6-Difluorophenyl)cyclobutyl)methanamine hydrochloride, [1-(2,6-Difluorophenyl)cyclobutyl]methanamine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g, 50mg.
[1-(2,6-difluorophenyl)cyclobutyl]methanamine;hydrochloride (CAS 1909335-91-6) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: [1-(2,6-difluorophenyl)cyclobutyl]methanamine;hydrochloride. InChIKey: RAOVYBJHTVUHBA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | [1-(2,6-difluorophenyl)cyclobutyl]methanamine;hydrochloride |
| InChIKey | RAOVYBJHTVUHBA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)