1-Benzyl-3-phenylthiourea, 98%
cas: 726-25-0 — see every product listed under this CAS number, including other names
1-Benzyl-3-phenylthiourea, 98% (CAS 726-25-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A655469-1g |
| cas | 726-25-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 642.94 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 247.72 Pln | |
| BLDpharm | 25g | 686.45 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 25g | 515.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-benzyl-3-phenylthiourea (CAS 726-25-0) is a chemical compound with the molecular formula C14H14N2S and a molecular weight of 242.34 g/mol. IUPAC name: 1-benzyl-3-phenylthiourea. InChIKey: NXCBDDGSOXJEFZ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 1-benzyl-3-phenylthiourea |
| InChIKey | NXCBDDGSOXJEFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=S)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)
