CAS 92192-94-4 appears in our catalog under these names: 1-Benzhydryl-2-thiourea, 95%, 1-Benzhydryl-2-thiourea. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
Benzhydrylthiourea (CAS 92192-94-4) is a chemical compound with the molecular formula C14H14N2S and a molecular weight of 242.34 g/mol. IUPAC name: benzhydrylthiourea. InChIKey: ORTDRGIAWHXESM-UHFFFAOYSA-N.
| Molecular formula | C14H14N2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | benzhydrylthiourea |
| InChIKey | ORTDRGIAWHXESM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NC(=S)N |
Computed by PubChem (NCBI)