CAS 51626-50-7 appears in our catalog under these names: 2-(1H-Indol-3-yl)-2-(thiophen-2-yl)ethanamine, 97%, 2-(1H-Indol-3-yl)-2-(thiophen-2-yl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 0,5g.
2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine (CAS 51626-50-7) is a chemical compound with the molecular formula C14H14N2S and a molecular weight of 242.34 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine. InChIKey: QLJAEMUUZBSJJF-UHFFFAOYSA-N.
| Molecular formula | C14H14N2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine |
| InChIKey | QLJAEMUUZBSJJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(CN)C3=CC=CS3 |
Computed by PubChem (NCBI)