CAS 1809607-84-8 is the registry number for 2,2'-((5-Methylthiophen-2-yl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-methylthiophen-2-yl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 1809607-84-8) is a chemical compound with the molecular formula C14H14N2S and a molecular weight of 242.34 g/mol. IUPAC name: 2-[(5-methylthiophen-2-yl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: IIKVBZWAQZCUQQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 2-[(5-methylthiophen-2-yl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | IIKVBZWAQZCUQQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C(C2=CC=CN2)C3=CC=CN3 |
Computed by PubChem (NCBI)