CAS 587-79-1 appears in our catalog under these names: 1-Benzyl-4-fluorobenzene, 99%, 99%, 4-Fluorodiphenylmethane, 95%, 4–Fluorodiphenylmethane, 4-Fluorodiphenylmethane, 95%+(GC-MS),RG. Offered by: Chemat, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-benzyl-4-fluorobenzene (CAS 587-79-1) is a chemical compound with the molecular formula C13H11F and a molecular weight of 186.22 g/mol. IUPAC name: 1-benzyl-4-fluorobenzene. InChIKey: ADCBAIUWZPOIMC-UHFFFAOYSA-N.
| Molecular formula | C13H11F |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 1-benzyl-4-fluorobenzene |
| InChIKey | ADCBAIUWZPOIMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)