1-Benzyl-4-fluorobenzene, 99%
cas: 587-79-1 — see every product listed under this CAS number, including other names
1-Benzyl-4-fluorobenzene, 99% (CAS 587-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A353728-1g |
| cas | 587-79-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| Ambeed | 25g | 2506.38 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 25g | 2440.40 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 753.09 Pln | |
| BLDpharm | 25g | 2452.49 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
1-benzyl-4-fluorobenzene (CAS 587-79-1) is a chemical compound with the molecular formula C13H11F and a molecular weight of 186.22 g/mol. IUPAC name: 1-benzyl-4-fluorobenzene. InChIKey: ADCBAIUWZPOIMC-UHFFFAOYSA-N.
| Molecular formula | C13H11F |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 1-benzyl-4-fluorobenzene |
| InChIKey | ADCBAIUWZPOIMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)