Products 82617-47-8
CAS 82617-47-8 is the registry number for 2-Fluoro-3-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-1-methyl-3-phenylbenzene (CAS 82617-47-8) is a chemical compound with the molecular formula C13H11F and a molecular weight of 186.22 g/mol. IUPAC name: 2-fluoro-1-methyl-3-phenylbenzene. InChIKey: LDFZYKVHPMKWKA-UHFFFAOYSA-N.
| Molecular formula | C13H11F |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 2-fluoro-1-methyl-3-phenylbenzene |
| InChIKey | LDFZYKVHPMKWKA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)