CAS 72093-42-6 is the registry number for 3-Fluoro-4'-methyl-1,1'-biphenyl, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-fluoro-3-(4-methylphenyl)benzene (CAS 72093-42-6) is a chemical compound with the molecular formula C13H11F and a molecular weight of 186.22 g/mol. IUPAC name: 1-fluoro-3-(4-methylphenyl)benzene. InChIKey: BGVOIDLAUFLERQ-UHFFFAOYSA-N.
| Molecular formula | C13H11F |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 1-fluoro-3-(4-methylphenyl)benzene |
| InChIKey | BGVOIDLAUFLERQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)