Products 69168-29-2
CAS 69168-29-2 is the registry number for 2-Fluoro-4-methyl-1,1'-biphenyl, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-fluoro-4-methyl-1-phenylbenzene (CAS 69168-29-2) is a chemical compound with the molecular formula C13H11F and a molecular weight of 186.22 g/mol. IUPAC name: 2-fluoro-4-methyl-1-phenylbenzene. InChIKey: ISXHZIQXRZTNKT-UHFFFAOYSA-N.
| Molecular formula | C13H11F |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 2-fluoro-4-methyl-1-phenylbenzene |
| InChIKey | ISXHZIQXRZTNKT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)