CAS 108717-96-0 appears in our catalog under these names: 1-Benzyl-4-phenyl-1,2,3-triazole, 97%, 97%, 1-Benzyl-4-phenyl-1H-1,2,3-triazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-benzyl-4-phenyltriazole (CAS 108717-96-0) is a chemical compound with the molecular formula C15H13N3 and a molecular weight of 235.28 g/mol. IUPAC name: 1-benzyl-4-phenyltriazole. InChIKey: GANAQXGHGKBVKP-UHFFFAOYSA-N.
| Molecular formula | C15H13N3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-benzyl-4-phenyltriazole |
| InChIKey | GANAQXGHGKBVKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)