CAS 216854-39-6 is the registry number for 1,3-Diphenyl-1H-pyrazol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-diphenylpyrazol-4-amine (CAS 216854-39-6) is a chemical compound with the molecular formula C15H13N3 and a molecular weight of 235.28 g/mol. IUPAC name: 1,3-diphenylpyrazol-4-amine. InChIKey: PKPYIIMUBKEZHX-UHFFFAOYSA-N.
| Molecular formula | C15H13N3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1,3-diphenylpyrazol-4-amine |
| InChIKey | PKPYIIMUBKEZHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)