CAS 108719-40-0 appears in our catalog under these names: 1,4-Diphenyl-1h-pyrazol-5-amine, 98%, 1,4-Diphenyl-1H-pyrazol-5-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
1,4-diphenylpyrazol-5-amine (CAS 108719-40-0) is a chemical compound with the molecular formula C15H13N3 and a molecular weight of 235.28 g/mol. IUPAC name: 1,4-diphenylpyrazol-5-amine. InChIKey: OGWIUGFQFNQLNI-UHFFFAOYSA-N.
| Molecular formula | C15H13N3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1,4-diphenylpyrazol-5-amine |
| InChIKey | OGWIUGFQFNQLNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N(N=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)