CAS 68809-42-7 is the registry number for 1-Phenyl-4-(p-tolyl)-1H-1,2,3-triazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-(4-methylphenyl)-1-phenyltriazole (CAS 68809-42-7) is a chemical compound with the molecular formula C15H13N3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-(4-methylphenyl)-1-phenyltriazole. InChIKey: FTBGPTZQAAMBJS-UHFFFAOYSA-N.
| Molecular formula | C15H13N3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 4-(4-methylphenyl)-1-phenyltriazole |
| InChIKey | FTBGPTZQAAMBJS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)