cas: 116041-19-1 — see every product listed under this CAS number, including other names
1-Benzyl-5-oxopyrrolidine-3-carboxamide 97% (CAS 116041-19-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A879230-250mg |
| cas | 116041-19-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 25g | 1744.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A879230 |
1-benzyl-5-oxopyrrolidine-3-carboxamide (CAS 116041-19-1) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 1-benzyl-5-oxopyrrolidine-3-carboxamide. InChIKey: GXFFGHGZXQWFHG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 1-benzyl-5-oxopyrrolidine-3-carboxamide |
| InChIKey | GXFFGHGZXQWFHG-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)