cas: 905590-04-7 — see every product listed under this CAS number, including other names
1-Benzyl-5-phenyl-1H-pyrazole-4-carboxylic Acid, ≥95%, ≥95% (CAS 905590-04-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN10-100mg |
| cas | 905590-04-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1370.00 Pln | |
| Chemat | 250mg | 2373.20 Pln | |
| Chemat | 1g | 3170.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-5-phenylpyrazole-4-carboxylic acid (CAS 905590-04-7) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 1-benzyl-5-phenylpyrazole-4-carboxylic acid. InChIKey: NASTYGSNQOILSK-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-benzyl-5-phenylpyrazole-4-carboxylic acid |
| InChIKey | NASTYGSNQOILSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(C=N2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)