CAS 905589-98-2 appears in our catalog under these names: 1-Benzyl-3-phenyl-1H-pyrazole-4-carboxylic acid, 98%, 98%, 1-Benzyl-3-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 1-Benzyl-3-phenyl-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 5mg, 25mg, 100mg, 1g, 250mg, 5g, 10g.
1-benzyl-3-phenylpyrazole-4-carboxylic acid (CAS 905589-98-2) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 1-benzyl-3-phenylpyrazole-4-carboxylic acid. InChIKey: NUMFTJJYFCUIDI-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-benzyl-3-phenylpyrazole-4-carboxylic acid |
| InChIKey | NUMFTJJYFCUIDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(=N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)