CAS 15409-48-0 appears in our catalog under these names: 5-Methyl-1,3-diphenyl-1H-pyrazole-4-carboxylic acid, 97%, 5-Methyl-1,3-diphenyl-1H-pyrazole-4-carboxylic acid, 98%, 5-Methyl-1,3-diphenyl-1H-pyrazole-4-carboxylic acid, 98%, 98%, 5-Methyl-1,3-diphenyl-1H-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg, 2.5g.
5-methyl-1,3-diphenylpyrazole-4-carboxylic acid (CAS 15409-48-0) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 5-methyl-1,3-diphenylpyrazole-4-carboxylic acid. InChIKey: FWIYNXGMTSTQBJ-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 5-methyl-1,3-diphenylpyrazole-4-carboxylic acid |
| InChIKey | FWIYNXGMTSTQBJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)