CAS 905590-04-7 appears in our catalog under these names: 1-Benzyl-5-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 1-Benzyl-5-phenyl-1H-pyrazole-4-carboxylic Acid, ≥95%, ≥95%, 1-Benzyl-5-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1-benzyl-5-phenylpyrazole-4-carboxylic acid (CAS 905590-04-7) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 1-benzyl-5-phenylpyrazole-4-carboxylic acid. InChIKey: NASTYGSNQOILSK-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-benzyl-5-phenylpyrazole-4-carboxylic acid |
| InChIKey | NASTYGSNQOILSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(C=N2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)