cas: 154195-30-9 — see every product listed under this CAS number, including other names
1-Benzylazepane-2,5-dione, 95%, 95% (CAS 154195-30-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANJC-100mg |
| cas | 154195-30-9 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzylazepane-2,5-dione (CAS 154195-30-9) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1-benzylazepane-2,5-dione. InChIKey: CTOCTUGUWVAJRP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 1-benzylazepane-2,5-dione |
| InChIKey | CTOCTUGUWVAJRP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(CCC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)