cas: 5731-18-0 — see every product listed under this CAS number, including other names
1-Benzylpyrrolidine-3-carboxylic acid, 98%(HPLC),RG, 98%(HPLC),RG (CAS 5731-18-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IA8O-250mg |
| cas | 5731-18-0 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 25g | 2622.80 Pln |
| purity | 98%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
1-benzylpyrrolidine-3-carboxylic acid (CAS 5731-18-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-benzylpyrrolidine-3-carboxylic acid. InChIKey: RLRDUQNUBMAYDS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-benzylpyrrolidine-3-carboxylic acid |
| InChIKey | RLRDUQNUBMAYDS-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)