CAS 85997-30-4 appears in our catalog under these names: 3–(Pyridin–4–yl)propyl methacrylate, 3-(Pyridin-4-yl)propyl methacrylate, 95%+, 2-Propenoic acid, 2-methyl-, 3-(4-pyridinyl)propyl ester, 95%, 2-Propenoic acid, 2-methyl-, 3-(4-pyridinyl)propyl ester, 95%+, 95%+. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-pyridin-4-ylpropyl 2-methylprop-2-enoate (CAS 85997-30-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 3-pyridin-4-ylpropyl 2-methylprop-2-enoate. InChIKey: JIOVONQDCZYUSM-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 3-pyridin-4-ylpropyl 2-methylprop-2-enoate |
| InChIKey | JIOVONQDCZYUSM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCC1=CC=NC=C1 |
Computed by PubChem (NCBI)