Products 2103401-56-3
CAS 2103401-56-3 appears in our catalog under these names: Trans-4-m-tolylpyrrolidine-3-carboxylic acid, 95%, trans-4-(m-Tolyl)pyrrolidine-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylic acid (CAS 2103401-56-3) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylic acid. InChIKey: UDNDGSKOCKZZPN-MNOVXSKESA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | UDNDGSKOCKZZPN-MNOVXSKESA-N |
| SMILES | CC1=CC(=CC=C1)[C@H]2CNC[C@@H]2C(=O)O |
Computed by PubChem (NCBI)