cas: 943736-61-6 — see every product listed under this CAS number, including other names
1-Boc-1,2,3,4-Tetrahydroquinoline-7-carbaldehyde, 97%, 97% (CAS 943736-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II4H-100mg |
| cas | 943736-61-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 500mg | 712.40 Pln | |
| Chemat | 1g | 1178.00 Pln | |
| Chemat | 5g | 3774.80 Pln | |
| Chemat | 10g | 6558.80 Pln | |
| Chemat | 25g | 13058.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-formyl-3,4-dihydro-2H-quinoline-1-carboxylate (CAS 943736-61-6) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl 7-formyl-3,4-dihydro-2H-quinoline-1-carboxylate. InChIKey: PBMPIXNWUFQHPR-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl 7-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| InChIKey | PBMPIXNWUFQHPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=C(C=C2)C=O |
Computed by PubChem (NCBI)