cas: 943736-61-6 — see every product listed under this CAS number, including other names
tert-Butyl 7-formyl-3,4-dihydroquinoline-1(2H)-carboxylate 95% (CAS 943736-61-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A798829-250mg |
| cas | 943736-61-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Ambeed | 5g | 4080.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A798829 |
Tert-butyl 7-formyl-3,4-dihydro-2H-quinoline-1-carboxylate (CAS 943736-61-6) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl 7-formyl-3,4-dihydro-2H-quinoline-1-carboxylate. InChIKey: PBMPIXNWUFQHPR-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl 7-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| InChIKey | PBMPIXNWUFQHPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=C(C=C2)C=O |
Computed by PubChem (NCBI)