1-Boc-2-methylpipecolinic acid 97%
cas: 746658-74-2 — see every product listed under this CAS number, including other names
1-Boc-2-methylpipecolinic acid 97% (CAS 746658-74-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212322-100mg |
| cas | 746658-74-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 876.56 Pln | |
| Ambeed | 10g | 1366.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A212322 |
2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 746658-74-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: BDAXXVZMKUJADB-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | BDAXXVZMKUJADB-UHFFFAOYSA-N |
| SMILES | CC1(CCCCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-[(tert-butoxy)carbonyl]-2-methylpiperidine-2-carboxylic acid, 1,2-Piperidinedicarboxylic acid, 2-methyl-, 1-(1,1-dimethylethyl) ester, 1-((tert-butoxy)carbonyl)-2-methylpiperidine-2-carboxylic acid, 1-(tert-Butoxycarbonyl)-2-methylpiperidine-2-carboxylic acid, 1-Boc-2-methylpipecolinic acid, 1-Boc-2-methyl-2-piperidinecarboxylic acid, 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid, 1-tert-butoxycarbonyl-2-methyl-piperidine-2-carboxylic acid, 2-Methyl-piperidine-1,2-dicarboxylic acid 1-tert-butyl ester, 2-Methyl-piperidine-1